C39H33FN2O4 — CID 10438746
9H-fluoren-9-ylmethyl N-[(2S)-1-fluoro-1,5-dioxo-5-(tritylamino)pentan-2-yl]carbamate (PubChem CID 10438746) has the molecular formula C39H33FN2O4 and a molecular weight of 612.70 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-1-fluoro-1,5-dioxo-5-(tritylamino)pentan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-fluoro-1,5-dioxo-5-(tritylamino)pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 10438746 |
| Molecular Formula | C39H33FN2O4 |
| Molecular Weight | 612.70 g/mol |
| Exact Mass | 612.24 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-fluoro-1,5-dioxo-5-(tritylamino)pentan-2-yl]carbamate |
| SMILES | O=C(CC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)F)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H33FN2O4/c40-37(44)35(41-38(45)46-26-34-32-22-12-10-20-30(32)31-21-11-13-23-33(31)34)24-25-36(43)42-39(27-14-4-1-5-15-27,28-16-6-2-7-17-28)29-18-8-3-9-19-29/h1-23,34-35H,24-26H2,(H,41,45)(H,42,43)/t35-/m0/s1 |
| InChIKey | KIOBSAAUCFEVPX-DHUJRADRSA-N |
| XLogP | 7.28 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.70 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|