C24H24N2O3 — CID 7408406
(2R)-2-amino-5-oxo-5-(tritylamino)pentanoic acid (PubChem CID 7408406) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is (2R)-2-amino-5-oxo-5-(tritylamino)pentanoic acid.
| Compound Name | (2R)-2-amino-5-oxo-5-(tritylamino)pentanoic acid |
|---|---|
| PubChem CID | 7408406 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (2R)-2-amino-5-oxo-5-(tritylamino)pentanoic acid |
| SMILES | N[C@H](CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H24N2O3/c25-21(23(28)29)16-17-22(27)26-24(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21H,16-17,25H2,(H,26,27)(H,28,29)/t21-/m1/s1 |
| InChIKey | XIFFJPJZPDCOJH-OAQYLSRUSA-N |
| XLogP | 3.29 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|