C25H26N2O3 — CID 121225741
(3S)-3-amino-6-oxo-6-(tritylamino)hexanoic acid (PubChem CID 121225741) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is (3S)-3-amino-6-oxo-6-(tritylamino)hexanoic acid.
| Compound Name | (3S)-3-amino-6-oxo-6-(tritylamino)hexanoic acid |
|---|---|
| PubChem CID | 121225741 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (3S)-3-amino-6-oxo-6-(tritylamino)hexanoic acid |
| SMILES | N[C@@H](CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)CC(=O)O |
| InChI | InChI=1S/C25H26N2O3/c26-22(18-24(29)30)16-17-23(28)27-25(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,22H,16-18,26H2,(H,27,28)(H,29,30)/t22-/m0/s1 |
| InChIKey | AMXVFOPSNORPRB-QFIPXVFZSA-N |
| XLogP | 3.68 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|