C25H23FmN2O4- — CID 166481771
fermium;5-oxo-2-(oxomethylamino)-5-(tritylamino)pentanoic acid (PubChem CID 166481771) has the molecular formula C25H23FmN2O4- and a molecular weight of 672.47 g/mol. Its IUPAC name is fermium;5-oxo-2-(oxomethylamino)-5-(tritylamino)pentanoic acid.
| Compound Name | fermium;5-oxo-2-(oxomethylamino)-5-(tritylamino)pentanoic acid |
|---|---|
| PubChem CID | 166481771 |
| Molecular Formula | C25H23FmN2O4- |
| Molecular Weight | 672.47 g/mol |
| Exact Mass | 672.26 |
| IUPAC Name | fermium;5-oxo-2-(oxomethylamino)-5-(tritylamino)pentanoic acid |
| SMILES | O=[C-]NC(CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O.[Fm] |
| InChI | InChI=1S/C25H23N2O4.Fm/c28-18-26-22(24(30)31)16-17-23(29)27-25(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21;/h1-15,22H,16-17H2,(H,26,28)(H,27,29)(H,30,31);/q-1; |
| InChIKey | FVJAFNLJZWBQMD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|