C30H33NO2 — CID 148701312
(4S)-4-methyl-5-oxo-N-trityldec-9-enamide (PubChem CID 148701312) has the molecular formula C30H33NO2 and a molecular weight of 439.60 g/mol. Its IUPAC name is (4S)-4-methyl-5-oxo-N-trityldec-9-enamide.
| Compound Name | (4S)-4-methyl-5-oxo-N-trityldec-9-enamide |
|---|---|
| PubChem CID | 148701312 |
| Molecular Formula | C30H33NO2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | (4S)-4-methyl-5-oxo-N-trityldec-9-enamide |
| SMILES | C=CCCCC(=O)[C@@H](C)CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H33NO2/c1-3-4-8-21-28(32)24(2)22-23-29(33)31-30(25-15-9-5-10-16-25,26-17-11-6-12-18-26)27-19-13-7-14-20-27/h3,5-7,9-20,24H,1,4,8,21-23H2,2H3,(H,31,33)/t24-/m0/s1 |
| InChIKey | NVKLVOYKMLCOPJ-DEOSSOPVSA-N |
| XLogP | 6.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|