C29H31NO2 — CID 160543510
(3S)-3-methyl-4-oxo-N-tritylnon-8-enamide (PubChem CID 160543510) has the molecular formula C29H31NO2 and a molecular weight of 425.57 g/mol. Its IUPAC name is (3S)-3-methyl-4-oxo-N-tritylnon-8-enamide.
| Compound Name | (3S)-3-methyl-4-oxo-N-tritylnon-8-enamide |
|---|---|
| PubChem CID | 160543510 |
| Molecular Formula | C29H31NO2 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | (3S)-3-methyl-4-oxo-N-tritylnon-8-enamide |
| SMILES | C=CCCCC(=O)[C@@H](C)CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H31NO2/c1-3-4-8-21-27(31)23(2)22-28(32)30-29(24-15-9-5-10-16-24,25-17-11-6-12-18-25)26-19-13-7-14-20-26/h3,5-7,9-20,23H,1,4,8,21-22H2,2H3,(H,30,32)/t23-/m0/s1 |
| InChIKey | QXCMFUMYZDSFEB-QHCPKHFHSA-N |
| XLogP | 6.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|