C37H40N4O5 — CID 146381702
methyl N-[2-[[4-oxo-2-(4-phenylbutanoylamino)-4-(tritylamino)butanoyl]amino]ethyl]carbamate (PubChem CID 146381702) has the molecular formula C37H40N4O5 and a molecular weight of 620.75 g/mol. Its IUPAC name is methyl N-[2-[[4-oxo-2-(4-phenylbutanoylamino)-4-(tritylamino)butanoyl]amino]ethyl]carbamate.
| Compound Name | methyl N-[2-[[4-oxo-2-(4-phenylbutanoylamino)-4-(tritylamino)butanoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 146381702 |
| Molecular Formula | C37H40N4O5 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | methyl N-[2-[[4-oxo-2-(4-phenylbutanoylamino)-4-(tritylamino)butanoyl]amino]ethyl]carbamate |
| SMILES | COC(=O)NCCNC(=O)C(CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C37H40N4O5/c1-46-36(45)39-26-25-38-35(44)32(40-33(42)24-14-17-28-15-6-2-7-16-28)27-34(43)41-37(29-18-8-3-9-19-29,30-20-10-4-11-21-30)31-22-12-5-13-23-31/h2-13,15-16,18-23,32H,14,17,24-27H2,1H3,(H,38,44)(H,39,45)(H,40,42)(H,41,43) |
| InChIKey | MQRHWKGJHKDXDS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|