C40H37N3O7 — CID 504774
(2S)-N-[2-(3,4-dihydroxyphenyl)ethyl]-2-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]-N'-tritylbutanediamide (PubChem CID 504774) has the molecular formula C40H37N3O7 and a molecular weight of 671.75 g/mol. Its IUPAC name is (2S)-N-[2-(3,4-dihydroxyphenyl)ethyl]-2-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]-N'-tritylbutanediamide.
| Compound Name | (2S)-N-[2-(3,4-dihydroxyphenyl)ethyl]-2-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]-N'-tritylbutanediamide |
|---|---|
| PubChem CID | 504774 |
| Molecular Formula | C40H37N3O7 |
| Molecular Weight | 671.75 g/mol |
| Exact Mass | 671.26 |
| IUPAC Name | (2S)-N-[2-(3,4-dihydroxyphenyl)ethyl]-2-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]-N'-tritylbutanediamide |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)N[C@@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C40H37N3O7/c44-33-19-16-27(24-35(33)46)18-21-37(48)42-32(39(50)41-23-22-28-17-20-34(45)36(47)25-28)26-38(49)43-40(29-10-4-1-5-11-29,30-12-6-2-7-13-30)31-14-8-3-9-15-31/h1-21,24-25,32,44-47H,22-23,26H2,(H,41,50)(H,42,48)(H,43,49)/t32-/m0/s1 |
| InChIKey | YMODCZZEDMASEK-YTTGMZPUSA-N |
| XLogP | 4.86 |
| TPSA | 168.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.75 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|