C30H33N3O8 — CID 22976137
benzyl N-[(4S)-5-[2-(3,4-dihydroxyphenyl)ethylamino]-4-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-5-oxopentyl]carbamate (PubChem CID 22976137) has the molecular formula C30H33N3O8 and a molecular weight of 563.61 g/mol. Its IUPAC name is benzyl N-[(4S)-5-[2-(3,4-dihydroxyphenyl)ethylamino]-4-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-5-oxopentyl]carbamate.
| Compound Name | benzyl N-[(4S)-5-[2-(3,4-dihydroxyphenyl)ethylamino]-4-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 22976137 |
| Molecular Formula | C30H33N3O8 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | benzyl N-[(4S)-5-[2-(3,4-dihydroxyphenyl)ethylamino]-4-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-5-oxopentyl]carbamate |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)N[C@@H](CCCNC(=O)OCc1ccccc1)C(=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C30H33N3O8/c34-24-11-8-20(17-26(24)36)10-13-28(38)33-23(29(39)31-16-14-21-9-12-25(35)27(37)18-21)7-4-15-32-30(40)41-19-22-5-2-1-3-6-22/h1-3,5-6,8-13,17-18,23,34-37H,4,7,14-16,19H2,(H,31,39)(H,32,40)(H,33,38)/b13-10+/t23-/m0/s1 |
| InChIKey | DQNAASJKHLNGNY-YYVWFHOOSA-N |
| XLogP | 3.07 |
| TPSA | 177.45 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|