C29H30N2O7 — CID 18711652
benzyl 3-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-4-[2-(4-hydroxy-3-methylphenyl)ethylamino]-4-oxobutanoate (PubChem CID 18711652) has the molecular formula C29H30N2O7 and a molecular weight of 518.57 g/mol. Its IUPAC name is benzyl 3-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-4-[2-(4-hydroxy-3-methylphenyl)ethylamino]-4-oxobutanoate.
| Compound Name | benzyl 3-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-4-[2-(4-hydroxy-3-methylphenyl)ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 18711652 |
| Molecular Formula | C29H30N2O7 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | benzyl 3-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-4-[2-(4-hydroxy-3-methylphenyl)ethylamino]-4-oxobutanoate |
| SMILES | Cc1cc(CCNC(=O)C(CC(=O)OCc2ccccc2)NC(=O)/C=C/c2ccc(O)c(O)c2)ccc1O |
| InChI | InChI=1S/C29H30N2O7/c1-19-15-21(7-10-24(19)32)13-14-30-29(37)23(17-28(36)38-18-22-5-3-2-4-6-22)31-27(35)12-9-20-8-11-25(33)26(34)16-20/h2-12,15-16,23,32-34H,13-14,17-18H2,1H3,(H,30,37)(H,31,35)/b12-9+ |
| InChIKey | PINNZCSAFIHTKF-FMIVXFBMSA-N |
| XLogP | 3.10 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|