C28H30N2O7 — CID 6478498
(2S)-N-[2-(3,4-dihydroxyphenyl)ethyl]-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-3-phenylmethoxybutanamide (PubChem CID 6478498) has the molecular formula C28H30N2O7 and a molecular weight of 506.56 g/mol. Its IUPAC name is (2S)-N-[2-(3,4-dihydroxyphenyl)ethyl]-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-3-phenylmethoxybutanamide.
| Compound Name | (2S)-N-[2-(3,4-dihydroxyphenyl)ethyl]-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-3-phenylmethoxybutanamide |
|---|---|
| PubChem CID | 6478498 |
| Molecular Formula | C28H30N2O7 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | (2S)-N-[2-(3,4-dihydroxyphenyl)ethyl]-2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-3-phenylmethoxybutanamide |
| SMILES | CC(OCc1ccccc1)[C@H](NC(=O)/C=C/c1ccc(O)c(O)c1)C(=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C28H30N2O7/c1-18(37-17-21-5-3-2-4-6-21)27(28(36)29-14-13-20-8-11-23(32)25(34)16-20)30-26(35)12-9-19-7-10-22(31)24(33)15-19/h2-12,15-16,18,27,31-34H,13-14,17H2,1H3,(H,29,36)(H,30,35)/b12-9+/t18?,27-/m0/s1 |
| InChIKey | LUROBYPGNUZOMR-KENAEDDCSA-N |
| XLogP | 2.97 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|