C19H19NO5 — CID 102068199
benzyl 2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]acetate (PubChem CID 102068199) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is benzyl 2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]acetate.
| Compound Name | benzyl 2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]acetate |
|---|---|
| PubChem CID | 102068199 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | benzyl 2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]acetate |
| SMILES | COc1cc(/C=C/C(=O)NCC(=O)OCc2ccccc2)ccc1O |
| InChI | InChI=1S/C19H19NO5/c1-24-17-11-14(7-9-16(17)21)8-10-18(22)20-12-19(23)25-13-15-5-3-2-4-6-15/h2-11,21H,12-13H2,1H3,(H,20,22)/b10-8+ |
| InChIKey | KMWMGGUZJDKWTB-CSKARUKUSA-N |
| XLogP | 2.27 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|