C37H36N2O6 — CID 158517150
(2E,4E)-N-benzyl-5-(3,4-dihydroxyphenyl)penta-2,4-dienamide;(2E,4E)-N-benzyl-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dienamide (PubChem CID 158517150) has the molecular formula C37H36N2O6 and a molecular weight of 604.70 g/mol. Its IUPAC name is (2E,4E)-N-benzyl-5-(3,4-dihydroxyphenyl)penta-2,4-dienamide;(2E,4E)-N-benzyl-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-N-benzyl-5-(3,4-dihydroxyphenyl)penta-2,4-dienamide;(2E,4E)-N-benzyl-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 158517150 |
| Molecular Formula | C37H36N2O6 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.26 |
| IUPAC Name | (2E,4E)-N-benzyl-5-(3,4-dihydroxyphenyl)penta-2,4-dienamide;(2E,4E)-N-benzyl-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dienamide |
| SMILES | COc1cc(/C=C/C=C/C(=O)NCc2ccccc2)ccc1O.O=C(/C=C/C=C/c1ccc(O)c(O)c1)NCc1ccccc1 |
| InChI | InChI=1S/C19H19NO3.C18H17NO3/c1-23-18-13-15(11-12-17(18)21)7-5-6-10-19(22)20-14-16-8-3-2-4-9-16;20-16-11-10-14(12-17(16)21)6-4-5-9-18(22)19-13-15-7-2-1-3-8-15/h2-13,21H,14H2,1H3,(H,20,22);1-12,20-21H,13H2,(H,19,22)/b7-5+,10-6+;6-4+,9-5+ |
| InChIKey | HLTQJDLOGRWEGA-QRWTWCOASA-N |
| XLogP | 6.27 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|