C18H18O3 — CID 11550934
(E)-1-(4-hydroxy-3-methoxyphenyl)-5-phenylpent-1-en-3-one (PubChem CID 11550934) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is (E)-1-(4-hydroxy-3-methoxyphenyl)-5-phenylpent-1-en-3-one.
| Compound Name | (E)-1-(4-hydroxy-3-methoxyphenyl)-5-phenylpent-1-en-3-one |
|---|---|
| PubChem CID | 11550934 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (E)-1-(4-hydroxy-3-methoxyphenyl)-5-phenylpent-1-en-3-one |
| SMILES | COc1cc(/C=C/C(=O)CCc2ccccc2)ccc1O |
| InChI | InChI=1S/C18H18O3/c1-21-18-13-15(9-12-17(18)20)8-11-16(19)10-7-14-5-3-2-4-6-14/h2-6,8-9,11-13,20H,7,10H2,1H3/b11-8+ |
| InChIKey | TVBPFVFIJYGRDA-DHZHZOJOSA-N |
| XLogP | 3.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|