C36H36N2O6 — CID 102432376
(E)-3-(4-hydroxy-3-methoxyphenyl)-N'-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-N,N'-bis(2-phenylethyl)prop-2-enehydrazide (PubChem CID 102432376) has the molecular formula C36H36N2O6 and a molecular weight of 592.69 g/mol. Its IUPAC name is (E)-3-(4-hydroxy-3-methoxyphenyl)-N'-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-N,N'-bis(2-phenylethyl)prop-2-enehydrazide.
| Compound Name | (E)-3-(4-hydroxy-3-methoxyphenyl)-N'-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-N,N'-bis(2-phenylethyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 102432376 |
| Molecular Formula | C36H36N2O6 |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | (E)-3-(4-hydroxy-3-methoxyphenyl)-N'-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-N,N'-bis(2-phenylethyl)prop-2-enehydrazide |
| SMILES | COc1cc(/C=C/C(=O)N(CCc2ccccc2)N(CCc2ccccc2)C(=O)/C=C/c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C36H36N2O6/c1-43-33-25-29(13-17-31(33)39)15-19-35(41)37(23-21-27-9-5-3-6-10-27)38(24-22-28-11-7-4-8-12-28)36(42)20-16-30-14-18-32(40)34(26-30)44-2/h3-20,25-26,39-40H,21-24H2,1-2H3/b19-15+,20-16+ |
| InChIKey | VRNUFYFRFYDKPE-MXWIWYRXSA-N |
| XLogP | 5.90 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|