C19H19NO5 — CID 155521354
3-[4-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]phenyl]propanoic acid (PubChem CID 155521354) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is 3-[4-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]phenyl]propanoic acid.
| Compound Name | 3-[4-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 155521354 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 3-[4-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]phenyl]propanoic acid |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccc(CCC(=O)O)cc2)ccc1O |
| InChI | InChI=1S/C19H19NO5/c1-25-17-12-14(4-9-16(17)21)5-10-18(22)20-15-7-2-13(3-8-15)6-11-19(23)24/h2-5,7-10,12,21H,6,11H2,1H3,(H,20,22)(H,23,24)/b10-5+ |
| InChIKey | LRVHICYAAHHJJL-BJMVGYQFSA-N |
| XLogP | 3.07 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|