C20H20N2O6 — CID 92529126
(2S)-2-[[2-[[(Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]acetyl]amino]-3-phenylpropanoic acid (PubChem CID 92529126) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is (2S)-2-[[2-[[(Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]acetyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[2-[[(Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 92529126 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (2S)-2-[[2-[[(Z)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]acetyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(/C=C\c1ccc(O)c(O)c1)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H20N2O6/c23-16-8-6-14(11-17(16)24)7-9-18(25)21-12-19(26)22-15(20(27)28)10-13-4-2-1-3-5-13/h1-9,11,15,23-24H,10,12H2,(H,21,25)(H,22,26)(H,27,28)/b9-7-/t15-/m0/s1 |
| InChIKey | GDFPXEHLNIQUJJ-VIHMKRCTSA-N |
| XLogP | 1.04 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|