C34H36N2O4 — CID 170220357
(2R)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-N'-tritylbutanediamide (PubChem CID 170220357) has the molecular formula C34H36N2O4 and a molecular weight of 536.67 g/mol. Its IUPAC name is (2R)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-N'-tritylbutanediamide.
| Compound Name | (2R)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-N'-tritylbutanediamide |
|---|---|
| PubChem CID | 170220357 |
| Molecular Formula | C34H36N2O4 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | (2R)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-N'-tritylbutanediamide |
| SMILES | COc1ccc(CCNC(=O)[C@H](C)CC(=O)NC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C34H36N2O4/c1-25(33(38)35-22-21-26-19-20-30(39-2)31(24-26)40-3)23-32(37)36-34(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-17-11-6-12-18-29/h4-20,24-25H,21-23H2,1-3H3,(H,35,38)(H,36,37)/t25-/m1/s1 |
| InChIKey | QLMRKKHDFFZURS-RUZDIDTESA-N |
| XLogP | 5.50 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|