C14H21N3O4 — CID 162388053
(2R)-2-amino-N-[2-(3,4-dimethoxyphenyl)ethyl]butanediamide (PubChem CID 162388053) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-(3,4-dimethoxyphenyl)ethyl]butanediamide.
| Compound Name | (2R)-2-amino-N-[2-(3,4-dimethoxyphenyl)ethyl]butanediamide |
|---|---|
| PubChem CID | 162388053 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | (2R)-2-amino-N-[2-(3,4-dimethoxyphenyl)ethyl]butanediamide |
| SMILES | COc1ccc(CCNC(=O)[C@H](N)CC(N)=O)cc1OC |
| InChI | InChI=1S/C14H21N3O4/c1-20-11-4-3-9(7-12(11)21-2)5-6-17-14(19)10(15)8-13(16)18/h3-4,7,10H,5-6,8,15H2,1-2H3,(H2,16,18)(H,17,19)/t10-/m1/s1 |
| InChIKey | LPFYZWWPAQUXSH-SNVBAGLBSA-N |
| XLogP | -0.43 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |