C29H34N4O6 — CID 123162957
N'-hydroxy-N-[3-methoxy-1-(naphthalen-1-ylmethylamino)-1-oxopropan-2-yl]-2-(4-phenylbutanoylamino)butanediamide (PubChem CID 123162957) has the molecular formula C29H34N4O6 and a molecular weight of 534.61 g/mol. Its IUPAC name is N'-hydroxy-N-[3-methoxy-1-(naphthalen-1-ylmethylamino)-1-oxopropan-2-yl]-2-(4-phenylbutanoylamino)butanediamide.
| Compound Name | N'-hydroxy-N-[3-methoxy-1-(naphthalen-1-ylmethylamino)-1-oxopropan-2-yl]-2-(4-phenylbutanoylamino)butanediamide |
|---|---|
| PubChem CID | 123162957 |
| Molecular Formula | C29H34N4O6 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | N'-hydroxy-N-[3-methoxy-1-(naphthalen-1-ylmethylamino)-1-oxopropan-2-yl]-2-(4-phenylbutanoylamino)butanediamide |
| SMILES | COCC(NC(=O)C(CC(=O)NO)NC(=O)CCCc1ccccc1)C(=O)NCc1cccc2ccccc12 |
| InChI | InChI=1S/C29H34N4O6/c1-39-19-25(28(36)30-18-22-14-8-13-21-12-5-6-15-23(21)22)32-29(37)24(17-27(35)33-38)31-26(34)16-7-11-20-9-3-2-4-10-20/h2-6,8-10,12-15,24-25,38H,7,11,16-19H2,1H3,(H,30,36)(H,31,34)(H,32,37)(H,33,35) |
| InChIKey | QAVXSQKZKXDGFE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|