C33H33FN4O5 — CID 129094488
(2S)-N-[(2S)-3-(4-fluorophenyl)-1-(naphthalen-1-ylmethylamino)-1-oxopropan-2-yl]-N'-hydroxy-2-(3-phenylpropanoylamino)butanediamide (PubChem CID 129094488) has the molecular formula C33H33FN4O5 and a molecular weight of 584.65 g/mol. Its IUPAC name is (2S)-N-[(2S)-3-(4-fluorophenyl)-1-(naphthalen-1-ylmethylamino)-1-oxopropan-2-yl]-N'-hydroxy-2-(3-phenylpropanoylamino)butanediamide.
| Compound Name | (2S)-N-[(2S)-3-(4-fluorophenyl)-1-(naphthalen-1-ylmethylamino)-1-oxopropan-2-yl]-N'-hydroxy-2-(3-phenylpropanoylamino)butanediamide |
|---|---|
| PubChem CID | 129094488 |
| Molecular Formula | C33H33FN4O5 |
| Molecular Weight | 584.65 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | (2S)-N-[(2S)-3-(4-fluorophenyl)-1-(naphthalen-1-ylmethylamino)-1-oxopropan-2-yl]-N'-hydroxy-2-(3-phenylpropanoylamino)butanediamide |
| SMILES | O=C(C[C@H](NC(=O)CCc1ccccc1)C(=O)N[C@@H](Cc1ccc(F)cc1)C(=O)NCc1cccc2ccccc12)NO |
| InChI | InChI=1S/C33H33FN4O5/c34-26-16-13-23(14-17-26)19-28(32(41)35-21-25-11-6-10-24-9-4-5-12-27(24)25)37-33(42)29(20-31(40)38-43)36-30(39)18-15-22-7-2-1-3-8-22/h1-14,16-17,28-29,43H,15,18-21H2,(H,35,41)(H,36,39)(H,37,42)(H,38,40)/t28-,29-/m0/s1 |
| InChIKey | QAMXTVKPLXQJDT-VMPREFPWSA-N |
| XLogP | 3.34 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.65 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|