C28H33N3O5 — CID 118226695
(3S)-4-[[(2S)-3-methoxy-1-(naphthalen-1-ylmethylamino)-1-oxopropan-2-yl]amino]-4-oxo-3-(3-phenylpropylamino)butanoic acid (PubChem CID 118226695) has the molecular formula C28H33N3O5 and a molecular weight of 491.59 g/mol. Its IUPAC name is (3S)-4-[[(2S)-3-methoxy-1-(naphthalen-1-ylmethylamino)-1-oxopropan-2-yl]amino]-4-oxo-3-(3-phenylpropylamino)butanoic acid.
| Compound Name | (3S)-4-[[(2S)-3-methoxy-1-(naphthalen-1-ylmethylamino)-1-oxopropan-2-yl]amino]-4-oxo-3-(3-phenylpropylamino)butanoic acid |
|---|---|
| PubChem CID | 118226695 |
| Molecular Formula | C28H33N3O5 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | (3S)-4-[[(2S)-3-methoxy-1-(naphthalen-1-ylmethylamino)-1-oxopropan-2-yl]amino]-4-oxo-3-(3-phenylpropylamino)butanoic acid |
| SMILES | COC[C@H](NC(=O)[C@H](CC(=O)O)NCCCc1ccccc1)C(=O)NCc1cccc2ccccc12 |
| InChI | InChI=1S/C28H33N3O5/c1-36-19-25(27(34)30-18-22-14-7-13-21-12-5-6-15-23(21)22)31-28(35)24(17-26(32)33)29-16-8-11-20-9-3-2-4-10-20/h2-7,9-10,12-15,24-25,29H,8,11,16-19H2,1H3,(H,30,34)(H,31,35)(H,32,33)/t24-,25-/m0/s1 |
| InChIKey | FZNZIIFFVFGPPW-DQEYMECFSA-N |
| XLogP | 2.65 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|