C28H32N4O4 — CID 118234330
(2S)-N-[(2S)-1-(naphthalen-1-ylmethylamino)-1-oxopropan-2-yl]-2-(4-phenylbutanoylamino)butanediamide (PubChem CID 118234330) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-(naphthalen-1-ylmethylamino)-1-oxopropan-2-yl]-2-(4-phenylbutanoylamino)butanediamide.
| Compound Name | (2S)-N-[(2S)-1-(naphthalen-1-ylmethylamino)-1-oxopropan-2-yl]-2-(4-phenylbutanoylamino)butanediamide |
|---|---|
| PubChem CID | 118234330 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | (2S)-N-[(2S)-1-(naphthalen-1-ylmethylamino)-1-oxopropan-2-yl]-2-(4-phenylbutanoylamino)butanediamide |
| SMILES | C[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)CCCc1ccccc1)C(=O)NCc1cccc2ccccc12 |
| InChI | InChI=1S/C28H32N4O4/c1-19(27(35)30-18-22-14-8-13-21-12-5-6-15-23(21)22)31-28(36)24(17-25(29)33)32-26(34)16-7-11-20-9-3-2-4-10-20/h2-6,8-10,12-15,19,24H,7,11,16-18H2,1H3,(H2,29,33)(H,30,35)(H,31,36)(H,32,34)/t19-,24-/m0/s1 |
| InChIKey | LEVREMURXBPIMO-CYFREDJKSA-N |
| XLogP | 2.34 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |