C35H44N4O5 — CID 146382015
2-[methyl-[2-(octanoylamino)-4-oxo-4-(tritylamino)butanoyl]amino]ethylcarbamic acid (PubChem CID 146382015) has the molecular formula C35H44N4O5 and a molecular weight of 600.76 g/mol. Its IUPAC name is 2-[methyl-[2-(octanoylamino)-4-oxo-4-(tritylamino)butanoyl]amino]ethylcarbamic acid.
| Compound Name | 2-[methyl-[2-(octanoylamino)-4-oxo-4-(tritylamino)butanoyl]amino]ethylcarbamic acid |
|---|---|
| PubChem CID | 146382015 |
| Molecular Formula | C35H44N4O5 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | 2-[methyl-[2-(octanoylamino)-4-oxo-4-(tritylamino)butanoyl]amino]ethylcarbamic acid |
| SMILES | CCCCCCCC(=O)NC(CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)N(C)CCNC(=O)O |
| InChI | InChI=1S/C35H44N4O5/c1-3-4-5-6-16-23-31(40)37-30(33(42)39(2)25-24-36-34(43)44)26-32(41)38-35(27-17-10-7-11-18-27,28-19-12-8-13-20-28)29-21-14-9-15-22-29/h7-15,17-22,30,36H,3-6,16,23-26H2,1-2H3,(H,37,40)(H,38,41)(H,43,44) |
| InChIKey | XRXVZWMFXAYNRS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|