C24H21FN2O4 — CID 175259532
[1-fluoro-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamic acid (PubChem CID 175259532) has the molecular formula C24H21FN2O4 and a molecular weight of 420.44 g/mol. Its IUPAC name is [1-fluoro-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamic acid.
| Compound Name | [1-fluoro-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 175259532 |
| Molecular Formula | C24H21FN2O4 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [1-fluoro-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamic acid |
| SMILES | O=C(O)NC(CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)F |
| InChI | InChI=1S/C24H21FN2O4/c25-22(29)20(26-23(30)31)16-21(28)27-24(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20,26H,16H2,(H,27,28)(H,30,31) |
| InChIKey | UELLUROYASHXSR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|