C27H31ClN2O3 — CID 138114608
tert-butyl 2-amino-4-oxo-4-(tritylamino)butanoate;hydrochloride (PubChem CID 138114608) has the molecular formula C27H31ClN2O3 and a molecular weight of 467.01 g/mol. Its IUPAC name is tert-butyl 2-amino-4-oxo-4-(tritylamino)butanoate;hydrochloride.
| Compound Name | tert-butyl 2-amino-4-oxo-4-(tritylamino)butanoate;hydrochloride |
|---|---|
| PubChem CID | 138114608 |
| Molecular Formula | C27H31ClN2O3 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | tert-butyl 2-amino-4-oxo-4-(tritylamino)butanoate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)C(N)CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C27H30N2O3.ClH/c1-26(2,3)32-25(31)23(28)19-24(30)29-27(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22;/h4-18,23H,19,28H2,1-3H3,(H,29,30);1H |
| InChIKey | YSGXCQJAUZBHHC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|