C26H30ClNO2S — CID 131697882
tert-butyl (2S)-2-amino-3-tritylsulfanylpropanoate;hydrochloride (PubChem CID 131697882) has the molecular formula C26H30ClNO2S and a molecular weight of 456.05 g/mol. Its IUPAC name is tert-butyl (2S)-2-amino-3-tritylsulfanylpropanoate;hydrochloride.
| Compound Name | tert-butyl (2S)-2-amino-3-tritylsulfanylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 131697882 |
| Molecular Formula | C26H30ClNO2S |
| Molecular Weight | 456.05 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | tert-butyl (2S)-2-amino-3-tritylsulfanylpropanoate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)[C@H](N)CSC(c1ccccc1)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C26H29NO2S.ClH/c1-25(2,3)29-24(28)23(27)19-30-26(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22;/h4-18,23H,19,27H2,1-3H3;1H/t23-;/m1./s1 |
| InChIKey | QPOWWSICTUFREA-GNAFDRTKSA-N |
| XLogP | 5.80 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.05 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|