C37H47N3O6S — CID 22788428
ditert-butyl (2S)-2-[[2-[[(2R)-2-amino-3-tritylsulfanylpropanoyl]amino]acetyl]amino]pentanedioate (PubChem CID 22788428) has the molecular formula C37H47N3O6S and a molecular weight of 661.87 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[2-[[(2R)-2-amino-3-tritylsulfanylpropanoyl]amino]acetyl]amino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[2-[[(2R)-2-amino-3-tritylsulfanylpropanoyl]amino]acetyl]amino]pentanedioate |
|---|---|
| PubChem CID | 22788428 |
| Molecular Formula | C37H47N3O6S |
| Molecular Weight | 661.87 g/mol |
| Exact Mass | 661.32 |
| IUPAC Name | ditert-butyl (2S)-2-[[2-[[(2R)-2-amino-3-tritylsulfanylpropanoyl]amino]acetyl]amino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)CNC(=O)[C@@H](N)CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H47N3O6S/c1-35(2,3)45-32(42)23-22-30(34(44)46-36(4,5)6)40-31(41)24-39-33(43)29(38)25-47-37(26-16-10-7-11-17-26,27-18-12-8-13-19-27)28-20-14-9-15-21-28/h7-21,29-30H,22-25,38H2,1-6H3,(H,39,43)(H,40,41)/t29-,30-/m0/s1 |
| InChIKey | FGTJTUUUKQJHKM-KYJUHHDHSA-N |
| XLogP | 5.10 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.87 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|