C39H51N3O6S — CID 137456281
tert-butyl (2S)-2-amino-5-[[(2S)-5-[(2-methylpropan-2-yl)oxy]-1,5-dioxo-1-(2-tritylsulfanylethylamino)pentan-2-yl]amino]-5-oxopentanoate (PubChem CID 137456281) has the molecular formula C39H51N3O6S and a molecular weight of 689.92 g/mol. Its IUPAC name is tert-butyl (2S)-2-amino-5-[[(2S)-5-[(2-methylpropan-2-yl)oxy]-1,5-dioxo-1-(2-tritylsulfanylethylamino)pentan-2-yl]amino]-5-oxopentanoate.
| Compound Name | tert-butyl (2S)-2-amino-5-[[(2S)-5-[(2-methylpropan-2-yl)oxy]-1,5-dioxo-1-(2-tritylsulfanylethylamino)pentan-2-yl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 137456281 |
| Molecular Formula | C39H51N3O6S |
| Molecular Weight | 689.92 g/mol |
| Exact Mass | 689.35 |
| IUPAC Name | tert-butyl (2S)-2-amino-5-[[(2S)-5-[(2-methylpropan-2-yl)oxy]-1,5-dioxo-1-(2-tritylsulfanylethylamino)pentan-2-yl]amino]-5-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)CC[C@H](N)C(=O)OC(C)(C)C)C(=O)NCCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H51N3O6S/c1-37(2,3)47-34(44)25-23-32(42-33(43)24-22-31(40)36(46)48-38(4,5)6)35(45)41-26-27-49-39(28-16-10-7-11-17-28,29-18-12-8-13-19-29)30-20-14-9-15-21-30/h7-21,31-32H,22-27,40H2,1-6H3,(H,41,45)(H,42,43)/t31-,32-/m0/s1 |
| InChIKey | OSAANFVRJVWLMV-ACHIHNKUSA-N |
| XLogP | 5.88 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.92 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|