C42H55NO7S — CID 69211675
ditert-butyl 2-[[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-tritylsulfanylpentanoyl]amino]butanedioate (PubChem CID 69211675) has the molecular formula C42H55NO7S and a molecular weight of 717.97 g/mol. Its IUPAC name is ditert-butyl 2-[[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-tritylsulfanylpentanoyl]amino]butanedioate.
| Compound Name | ditert-butyl 2-[[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-tritylsulfanylpentanoyl]amino]butanedioate |
|---|---|
| PubChem CID | 69211675 |
| Molecular Formula | C42H55NO7S |
| Molecular Weight | 717.97 g/mol |
| Exact Mass | 717.37 |
| IUPAC Name | ditert-butyl 2-[[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-tritylsulfanylpentanoyl]amino]butanedioate |
| SMILES | CC(C)(C)OC(=O)CC(CCCSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)NC(CC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C42H55NO7S/c1-39(2,3)48-35(44)28-30(37(46)43-34(38(47)50-41(7,8)9)29-36(45)49-40(4,5)6)20-19-27-51-42(31-21-13-10-14-22-31,32-23-15-11-16-24-32)33-25-17-12-18-26-33/h10-18,21-26,30,34H,19-20,27-29H2,1-9H3,(H,43,46) |
| InChIKey | FOVFEJMDGXPRQT-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.97 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|