C50H49ClN2O5S — CID 153492232
tert-butyl (3S)-3-amino-4-[[(2R)-1-[(2-chlorophenyl)-(4-methylphenyl)-phenylmethoxy]-1-oxo-3-tritylsulfanylpropan-2-yl]amino]-4-oxobutanoate (PubChem CID 153492232) has the molecular formula C50H49ClN2O5S and a molecular weight of 825.47 g/mol. Its IUPAC name is tert-butyl (3S)-3-amino-4-[[(2R)-1-[(2-chlorophenyl)-(4-methylphenyl)-phenylmethoxy]-1-oxo-3-tritylsulfanylpropan-2-yl]amino]-4-oxobutanoate.
| Compound Name | tert-butyl (3S)-3-amino-4-[[(2R)-1-[(2-chlorophenyl)-(4-methylphenyl)-phenylmethoxy]-1-oxo-3-tritylsulfanylpropan-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 153492232 |
| Molecular Formula | C50H49ClN2O5S |
| Molecular Weight | 825.47 g/mol |
| Exact Mass | 824.31 |
| IUPAC Name | tert-butyl (3S)-3-amino-4-[[(2R)-1-[(2-chlorophenyl)-(4-methylphenyl)-phenylmethoxy]-1-oxo-3-tritylsulfanylpropan-2-yl]amino]-4-oxobutanoate |
| SMILES | Cc1ccc(C(OC(=O)[C@H](CSC(c2ccccc2)(c2ccccc2)c2ccccc2)NC(=O)[C@@H](N)CC(=O)OC(C)(C)C)(c2ccccc2)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C50H49ClN2O5S/c1-35-29-31-37(32-30-35)49(36-19-9-5-10-20-36,41-27-17-18-28-42(41)51)58-47(56)44(53-46(55)43(52)33-45(54)57-48(2,3)4)34-59-50(38-21-11-6-12-22-38,39-23-13-7-14-24-39)40-25-15-8-16-26-40/h5-32,43-44H,33-34,52H2,1-4H3,(H,53,55)/t43-,44-,49?/m0/s1 |
| InChIKey | HIAXCKWEEVNPBU-VKVBXYRZSA-N |
| XLogP | 9.75 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.47 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|