C42H35Cl2NO2S — CID 51341078
[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (2R)-2-amino-3-[(2-chlorophenyl)-diphenylmethyl]sulfanylpropanoate (PubChem CID 51341078) has the molecular formula C42H35Cl2NO2S and a molecular weight of 688.72 g/mol. Its IUPAC name is [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (2R)-2-amino-3-[(2-chlorophenyl)-diphenylmethyl]sulfanylpropanoate.
| Compound Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (2R)-2-amino-3-[(2-chlorophenyl)-diphenylmethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 51341078 |
| Molecular Formula | C42H35Cl2NO2S |
| Molecular Weight | 688.72 g/mol |
| Exact Mass | 687.18 |
| IUPAC Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (2R)-2-amino-3-[(2-chlorophenyl)-diphenylmethyl]sulfanylpropanoate |
| SMILES | Cc1ccc(C(OC(=O)[C@@H](N)CSC(c2ccccc2)(c2ccccc2)c2ccccc2Cl)(c2ccccc2)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C42H35Cl2NO2S/c1-30-25-27-32(28-26-30)41(31-15-5-2-6-16-31,35-21-11-13-23-37(35)43)47-40(46)39(45)29-48-42(33-17-7-3-8-18-33,34-19-9-4-10-20-34)36-22-12-14-24-38(36)44/h2-28,39H,29,45H2,1H3/t39-,41?/m0/s1 |
| InChIKey | FDZPHVNNEJGCTO-JFKYFZFSSA-N |
| XLogP | 10.19 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.72 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|