C27H22ClNO2 — CID 51341065
[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 3-aminobenzoate (PubChem CID 51341065) has the molecular formula C27H22ClNO2 and a molecular weight of 427.93 g/mol. Its IUPAC name is [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 3-aminobenzoate.
| Compound Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 3-aminobenzoate |
|---|---|
| PubChem CID | 51341065 |
| Molecular Formula | C27H22ClNO2 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 3-aminobenzoate |
| SMILES | Cc1ccc(C(OC(=O)c2cccc(N)c2)(c2ccccc2)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C27H22ClNO2/c1-19-14-16-22(17-15-19)27(21-9-3-2-4-10-21,24-12-5-6-13-25(24)28)31-26(30)20-8-7-11-23(29)18-20/h2-18H,29H2,1H3 |
| InChIKey | ZIYSMXIOWVAYGA-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|