C37H30ClNO4 — CID 51341072
[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate (PubChem CID 51341072) has the molecular formula C37H30ClNO4 and a molecular weight of 588.10 g/mol. Its IUPAC name is [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate.
| Compound Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 51341072 |
| Molecular Formula | C37H30ClNO4 |
| Molecular Weight | 588.10 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate |
| SMILES | Cc1ccc(C(OC(=O)CNC(=O)OCC2c3ccccc3-c3ccccc32)(c2ccccc2)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C37H30ClNO4/c1-25-19-21-27(22-20-25)37(26-11-3-2-4-12-26,33-17-9-10-18-34(33)38)43-35(40)23-39-36(41)42-24-32-30-15-7-5-13-28(30)29-14-6-8-16-31(29)32/h2-22,32H,23-24H2,1H3,(H,39,41) |
| InChIKey | VJYVVVWVLDPPGA-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.10 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|