C40H36ClNO5 — CID 59963061
[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxypentanoate (PubChem CID 59963061) has the molecular formula C40H36ClNO5 and a molecular weight of 646.18 g/mol. Its IUPAC name is [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxypentanoate.
| Compound Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxypentanoate |
|---|---|
| PubChem CID | 59963061 |
| Molecular Formula | C40H36ClNO5 |
| Molecular Weight | 646.18 g/mol |
| Exact Mass | 645.23 |
| IUPAC Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxypentanoate |
| SMILES | CC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(O)C(=O)OC(c1ccccc1)(c1ccc(C)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C40H36ClNO5/c1-3-36(42-39(45)46-25-33-31-17-9-7-15-29(31)30-16-8-10-18-32(30)33)37(43)38(44)47-40(27-13-5-4-6-14-27,28-23-21-26(2)22-24-28)34-19-11-12-20-35(34)41/h4-24,33,36-37,43H,3,25H2,1-2H3,(H,42,45)/t36-,37?,40?/m0/s1 |
| InChIKey | CLPLKFLVNXDGCG-GTAGSRNNSA-N |
| XLogP | 8.16 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.18 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|