C50H56ClNO10 — CID 121336637
[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 3-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 121336637) has the molecular formula C50H56ClNO10 and a molecular weight of 866.45 g/mol. Its IUPAC name is [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 3-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 3-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 121336637 |
| Molecular Formula | C50H56ClNO10 |
| Molecular Weight | 866.45 g/mol |
| Exact Mass | 865.36 |
| IUPAC Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 3-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | Cc1ccc(C(OC(=O)CCOCCOCCOCCOCCOCCOCCNC(=O)OCC2c3ccccc3-c3ccccc32)(c2ccccc2)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C50H56ClNO10/c1-38-19-21-40(22-20-38)50(39-11-3-2-4-12-39,46-17-9-10-18-47(46)51)62-48(53)23-25-55-27-29-57-31-33-59-35-36-60-34-32-58-30-28-56-26-24-52-49(54)61-37-45-43-15-7-5-13-41(43)42-14-6-8-16-44(42)45/h2-22,45H,23-37H2,1H3,(H,52,54) |
| InChIKey | AXMDJGKUYMDBPA-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.45 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|