C36H28ClNO4 — CID 121233561
[(2-chlorophenyl)-diphenylmethyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate (PubChem CID 121233561) has the molecular formula C36H28ClNO4 and a molecular weight of 574.08 g/mol. Its IUPAC name is [(2-chlorophenyl)-diphenylmethyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate.
| Compound Name | [(2-chlorophenyl)-diphenylmethyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 121233561 |
| Molecular Formula | C36H28ClNO4 |
| Molecular Weight | 574.08 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | [(2-chlorophenyl)-diphenylmethyl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate |
| SMILES | O=C(CNC(=O)OCC1c2ccccc2-c2ccccc21)OC(c1ccccc1)(c1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C36H28ClNO4/c37-33-22-12-11-21-32(33)36(25-13-3-1-4-14-25,26-15-5-2-6-16-26)42-34(39)23-38-35(40)41-24-31-29-19-9-7-17-27(29)28-18-8-10-20-30(28)31/h1-22,31H,23-24H2,(H,38,40) |
| InChIKey | RUMJBOQZWDGYKD-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.08 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|