C17H14ClNO3 — CID 11758879
9H-fluoren-9-ylmethyl N-(2-chloro-2-oxoethyl)carbamate (PubChem CID 11758879) has the molecular formula C17H14ClNO3 and a molecular weight of 315.76 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(2-chloro-2-oxoethyl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(2-chloro-2-oxoethyl)carbamate |
|---|---|
| PubChem CID | 11758879 |
| Molecular Formula | C17H14ClNO3 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(2-chloro-2-oxoethyl)carbamate |
| SMILES | O=C(Cl)CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C17H14ClNO3/c18-16(20)9-19-17(21)22-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15H,9-10H2,(H,19,21) |
| InChIKey | HFWFBOCOXPEKBV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|