C24H28N2O3 — CID 170794400
9H-fluoren-9-ylmethyl N-[2-(cycloheptylamino)-2-oxoethyl]carbamate (PubChem CID 170794400) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2-(cycloheptylamino)-2-oxoethyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2-(cycloheptylamino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 170794400 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-(cycloheptylamino)-2-oxoethyl]carbamate |
| SMILES | O=C(CNC(=O)OCC1c2ccccc2-c2ccccc21)NC1CCCCCC1 |
| InChI | InChI=1S/C24H28N2O3/c27-23(26-17-9-3-1-2-4-10-17)15-25-24(28)29-16-22-20-13-7-5-11-18(20)19-12-6-8-14-21(19)22/h5-8,11-14,17,22H,1-4,9-10,15-16H2,(H,25,28)(H,26,27) |
| InChIKey | UNRVNAKZSZOZQL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |