C20H20N2O6 — CID 134309423
ethyl [[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino] carbonate (PubChem CID 134309423) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is ethyl [[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino] carbonate.
| Compound Name | ethyl [[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino] carbonate |
|---|---|
| PubChem CID | 134309423 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | ethyl [[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino] carbonate |
| SMILES | CCOC(=O)ONC(=O)CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H20N2O6/c1-2-26-20(25)28-22-18(23)11-21-19(24)27-12-17-15-9-5-3-7-13(15)14-8-4-6-10-16(14)17/h3-10,17H,2,11-12H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | GHZXRRPBWNKQOT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|