C17H14NO4- — CID 6921612
2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate (PubChem CID 6921612) has the molecular formula C17H14NO4- and a molecular weight of 296.30 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 6921612 |
| Molecular Formula | C17H14NO4- |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate |
| SMILES | O=C([O-])CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C17H15NO4/c19-16(20)9-18-17(21)22-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15H,9-10H2,(H,18,21)(H,19,20)/p-1 |
| InChIKey | NDKDFTQNXLHCGO-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |