C23H24NNaO4 — CID 69129851
sodium 4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]cyclohexane-1-carboxylate (PubChem CID 69129851) has the molecular formula C23H24NNaO4 and a molecular weight of 401.44 g/mol. Its IUPAC name is sodium 4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]cyclohexane-1-carboxylate.
| Compound Name | sodium 4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 69129851 |
| Molecular Formula | C23H24NNaO4 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | sodium 4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]cyclohexane-1-carboxylate |
| SMILES | O=C(NCC1CCC(C(=O)[O-])CC1)OCC1c2ccccc2-c2ccccc21.[Na+] |
| InChI | InChI=1S/C23H25NO4.Na/c25-22(26)16-11-9-15(10-12-16)13-24-23(27)28-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21;/h1-8,15-16,21H,9-14H2,(H,24,27)(H,25,26);/q;+1/p-1 |
| InChIKey | NJCMBXQQWRWHCQ-UHFFFAOYSA-M |
| XLogP | 0.09 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |