About 9H-fluoren-9-ylmethyl N-aminocarbamate;hydrochloride
9H-fluoren-9-ylmethyl N-aminocarbamate;hydrochloride (PubChem CID 23080809) has the molecular formula C15H15ClN2O2
and a molecular weight of 290.75 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-aminocarbamate;hydrochloride.
Molecular Properties
| Compound Name | 9H-fluoren-9-ylmethyl N-aminocarbamate;hydrochloride |
| PubChem CID | 23080809 |
| Molecular Formula | C15H15ClN2O2 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-aminocarbamate;hydrochloride |
| SMILES | Cl.NNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C15H14N2O2.ClH/c16-17-15(18)19-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14;/h1-8,14H,9,16H2,(H,17,18);1H |
| InChIKey | DANJJHKOQXKRDA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-9-ylmethyl N-aminocarbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-ylmethyl N-aminocarbamate;hydrochloride?
The IUPAC name of 9H-fluoren-9-ylmethyl N-aminocarbamate;hydrochloride (CID 23080809) is 9H-fluoren-9-ylmethyl N-aminocarbamate;hydrochloride.
What is the SMILES notation for 9H-fluoren-9-ylmethyl N-aminocarbamate;hydrochloride?
The canonical SMILES for 9H-fluoren-9-ylmethyl N-aminocarbamate;hydrochloride is Cl.NNC(=O)OCC1c2ccccc2-c2ccccc21.
What is the InChIKey of 9H-fluoren-9-ylmethyl N-aminocarbamate;hydrochloride?
The InChIKey is DANJJHKOQXKRDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2.ClH/c16-17-15(18)19-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14;/h1-8,14H,9,16H2,(H,17,18);1H.
What are the key properties of 9H-fluoren-9-ylmethyl N-aminocarbamate;hydrochloride?
9H-fluoren-9-ylmethyl N-aminocarbamate;hydrochloride has a molecular weight of 290.75 g/mol, XLogP of 2.82, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-ylmethyl N-aminocarbamate;hydrochloride is sourced from PubChem (CID 23080809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).