About 9H-fluoren-9-ylmethyl N-iodocarbamate
9H-fluoren-9-ylmethyl N-iodocarbamate (PubChem CID 118176347) has the molecular formula C15H12INO2
and a molecular weight of 365.17 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-iodocarbamate.
Molecular Properties
| Compound Name | 9H-fluoren-9-ylmethyl N-iodocarbamate |
| PubChem CID | 118176347 |
| Molecular Formula | C15H12INO2 |
| Molecular Weight | 365.17 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-iodocarbamate |
| SMILES | O=C(NI)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C15H12INO2/c16-17-15(18)19-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H,9H2,(H,17,18) |
| InChIKey | FHICQZYSDHQPRP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.17 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-9-ylmethyl N-iodocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-ylmethyl N-iodocarbamate?
The IUPAC name of 9H-fluoren-9-ylmethyl N-iodocarbamate (CID 118176347) is 9H-fluoren-9-ylmethyl N-iodocarbamate.
What is the SMILES notation for 9H-fluoren-9-ylmethyl N-iodocarbamate?
The canonical SMILES for 9H-fluoren-9-ylmethyl N-iodocarbamate is O=C(NI)OCC1c2ccccc2-c2ccccc21.
What is the InChIKey of 9H-fluoren-9-ylmethyl N-iodocarbamate?
The InChIKey is FHICQZYSDHQPRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12INO2/c16-17-15(18)19-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H,9H2,(H,17,18).
What are the key properties of 9H-fluoren-9-ylmethyl N-iodocarbamate?
9H-fluoren-9-ylmethyl N-iodocarbamate has a molecular weight of 365.17 g/mol, XLogP of 3.88, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-ylmethyl N-iodocarbamate is sourced from PubChem (CID 118176347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).