C21H18N2O2 — CID 11450338
9H-fluoren-9-ylmethyl N-(4-aminophenyl)carbamate (PubChem CID 11450338) has the molecular formula C21H18N2O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(4-aminophenyl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(4-aminophenyl)carbamate |
|---|---|
| PubChem CID | 11450338 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(4-aminophenyl)carbamate |
| SMILES | Nc1ccc(NC(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C21H18N2O2/c22-14-9-11-15(12-10-14)23-21(24)25-13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-12,20H,13,22H2,(H,23,24) |
| InChIKey | ALQJHOXOLDYSLS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|