C24H22N2O2 — CID 175653920
9H-fluoren-9-ylmethyl N-[4-(1-aminocyclopropyl)phenyl]carbamate (PubChem CID 175653920) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(1-aminocyclopropyl)phenyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(1-aminocyclopropyl)phenyl]carbamate |
|---|---|
| PubChem CID | 175653920 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(1-aminocyclopropyl)phenyl]carbamate |
| SMILES | NC1(c2ccc(NC(=O)OCC3c4ccccc4-c4ccccc43)cc2)CC1 |
| InChI | InChI=1S/C24H22N2O2/c25-24(13-14-24)16-9-11-17(12-10-16)26-23(27)28-15-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-12,22H,13-15,25H2,(H,26,27) |
| InChIKey | RFBLSHLDRCIXEI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |