C24H19NO3S — CID 71602980
9H-fluoren-9-ylmethyl N-(4-oxo-2,3-dihydrothiochromen-6-yl)carbamate (PubChem CID 71602980) has the molecular formula C24H19NO3S and a molecular weight of 401.49 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(4-oxo-2,3-dihydrothiochromen-6-yl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(4-oxo-2,3-dihydrothiochromen-6-yl)carbamate |
|---|---|
| PubChem CID | 71602980 |
| Molecular Formula | C24H19NO3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(4-oxo-2,3-dihydrothiochromen-6-yl)carbamate |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)CCS2)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H19NO3S/c26-22-11-12-29-23-10-9-15(13-20(22)23)25-24(27)28-14-21-18-7-3-1-5-16(18)17-6-2-4-8-19(17)21/h1-10,13,21H,11-12,14H2,(H,25,27) |
| InChIKey | AHKBSIMVOJNKKH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |