C31H29N3O4 — CID 125126905
9H-fluoren-9-ylmethyl N-[2-oxo-4-(2-oxo-2-piperidin-1-ylethyl)-1H-quinolin-7-yl]carbamate (PubChem CID 125126905) has the molecular formula C31H29N3O4 and a molecular weight of 507.59 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2-oxo-4-(2-oxo-2-piperidin-1-ylethyl)-1H-quinolin-7-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2-oxo-4-(2-oxo-2-piperidin-1-ylethyl)-1H-quinolin-7-yl]carbamate |
|---|---|
| PubChem CID | 125126905 |
| Molecular Formula | C31H29N3O4 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-oxo-4-(2-oxo-2-piperidin-1-ylethyl)-1H-quinolin-7-yl]carbamate |
| SMILES | O=C(Nc1ccc2c(CC(=O)N3CCCCC3)cc(=O)[nH]c2c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H29N3O4/c35-29-16-20(17-30(36)34-14-6-1-7-15-34)22-13-12-21(18-28(22)33-29)32-31(37)38-19-27-25-10-4-2-8-23(25)24-9-3-5-11-26(24)27/h2-5,8-13,16,18,27H,1,6-7,14-15,17,19H2,(H,32,37)(H,33,35) |
| InChIKey | JMRBJUPNZNFXHC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |