C29H25NO6 — CID 16720102
ethyl 2-[7-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methyl-2-oxochromen-3-yl]acetate (PubChem CID 16720102) has the molecular formula C29H25NO6 and a molecular weight of 483.52 g/mol. Its IUPAC name is ethyl 2-[7-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methyl-2-oxochromen-3-yl]acetate.
| Compound Name | ethyl 2-[7-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methyl-2-oxochromen-3-yl]acetate |
|---|---|
| PubChem CID | 16720102 |
| Molecular Formula | C29H25NO6 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | ethyl 2-[7-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methyl-2-oxochromen-3-yl]acetate |
| SMILES | CCOC(=O)Cc1c(C)c2ccc(NC(=O)OCC3c4ccccc4-c4ccccc43)cc2oc1=O |
| InChI | InChI=1S/C29H25NO6/c1-3-34-27(31)15-24-17(2)19-13-12-18(14-26(19)36-28(24)32)30-29(33)35-16-25-22-10-6-4-8-20(22)21-9-5-7-11-23(21)25/h4-14,25H,3,15-16H2,1-2H3,(H,30,33) |
| InChIKey | YHGLTCUKVMWCGO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|