C30H30ClN3O5 — CID 172882951
9H-fluoren-9-ylmethyl N-[5-amino-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]carbamate;hydrochloride (PubChem CID 172882951) has the molecular formula C30H30ClN3O5 and a molecular weight of 548.04 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[5-amino-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]carbamate;hydrochloride.
| Compound Name | 9H-fluoren-9-ylmethyl N-[5-amino-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 172882951 |
| Molecular Formula | C30H30ClN3O5 |
| Molecular Weight | 548.04 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[5-amino-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]carbamate;hydrochloride |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)C(CCCN)NC(=O)OCC3c4ccccc4-c4ccccc43)ccc12.Cl |
| InChI | InChI=1S/C30H29N3O5.ClH/c1-18-15-28(34)38-27-16-19(12-13-20(18)27)32-29(35)26(11-6-14-31)33-30(36)37-17-25-23-9-4-2-7-21(23)22-8-3-5-10-24(22)25;/h2-5,7-10,12-13,15-16,25-26H,6,11,14,17,31H2,1H3,(H,32,35)(H,33,36);1H |
| InChIKey | NMUCXBUMUFTORA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.04 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|